C19H33IN2O3S — CID 70411510
N-[4-[1-hydroxy-1-iodo-2-(nonan-3-ylamino)ethyl]-2-methylphenyl]methanesulfonamide (PubChem CID 70411510) has the molecular formula C19H33IN2O3S and a molecular weight of 496.46 g/mol. Its IUPAC name is N-[4-[1-hydroxy-1-iodo-2-(nonan-3-ylamino)ethyl]-2-methylphenyl]methanesulfonamide.
| Compound Name | N-[4-[1-hydroxy-1-iodo-2-(nonan-3-ylamino)ethyl]-2-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70411510 |
| Molecular Formula | C19H33IN2O3S |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | N-[4-[1-hydroxy-1-iodo-2-(nonan-3-ylamino)ethyl]-2-methylphenyl]methanesulfonamide |
| SMILES | CCCCCCC(CC)NCC(O)(I)c1ccc(NS(C)(=O)=O)c(C)c1 |
| InChI | InChI=1S/C19H33IN2O3S/c1-5-7-8-9-10-17(6-2)21-14-19(20,23)16-11-12-18(15(3)13-16)22-26(4,24)25/h11-13,17,21-23H,5-10,14H2,1-4H3 |
| InChIKey | XETUNDICHRNMAE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|