C27H46N2O9S — CID 70466779
2-hydroxypropane-1,2,3-tricarboxylic acid;N-[4-[4-(nonan-3-ylamino)pentyl]phenyl]methanesulfonamide (PubChem CID 70466779) has the molecular formula C27H46N2O9S and a molecular weight of 574.74 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;N-[4-[4-(nonan-3-ylamino)pentyl]phenyl]methanesulfonamide.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;N-[4-[4-(nonan-3-ylamino)pentyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 70466779 |
| Molecular Formula | C27H46N2O9S |
| Molecular Weight | 574.74 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;N-[4-[4-(nonan-3-ylamino)pentyl]phenyl]methanesulfonamide |
| SMILES | CCCCCCC(CC)NC(C)CCCc1ccc(NS(C)(=O)=O)cc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H38N2O2S.C6H8O7/c1-5-7-8-9-13-20(6-2)22-18(3)11-10-12-19-14-16-21(17-15-19)23-26(4,24)25;7-3(8)1-6(13,5(11)12)2-4(9)10/h14-18,20,22-23H,5-13H2,1-4H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | RFNIOKUXZBOTKN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 190.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.74 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|