C14H22Cl2N6 — CID 67799691
1-(diaminomethylidenehydrazinylidene)-2-propyl-2,3-dihydroindene-4-carboximidamide;dihydrochloride (PubChem CID 67799691) has the molecular formula C14H22Cl2N6 and a molecular weight of 345.28 g/mol. Its IUPAC name is 1-(diaminomethylidenehydrazinylidene)-2-propyl-2,3-dihydroindene-4-carboximidamide;dihydrochloride.
| Compound Name | 1-(diaminomethylidenehydrazinylidene)-2-propyl-2,3-dihydroindene-4-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 67799691 |
| Molecular Formula | C14H22Cl2N6 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-(diaminomethylidenehydrazinylidene)-2-propyl-2,3-dihydroindene-4-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1cccc2c1CC(CCC)C2=NN=C(N)N |
| InChI | InChI=1S/C14H20N6.2ClH/c1-2-4-8-7-11-9(12(8)19-20-14(17)18)5-3-6-10(11)13(15)16;;/h3,5-6,8H,2,4,7H2,1H3,(H3,15,16)(H4,17,18,20);2*1H |
| InChIKey | YFOFMUFSROOTBW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 126.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|