C11H12N2O — CID 19042291
3-methyl-1-oxo-2,3-dihydroindene-4-carboximidamide (PubChem CID 19042291) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-methyl-1-oxo-2,3-dihydroindene-4-carboximidamide.
| Compound Name | 3-methyl-1-oxo-2,3-dihydroindene-4-carboximidamide |
|---|---|
| PubChem CID | 19042291 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 3-methyl-1-oxo-2,3-dihydroindene-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccc2c1C(C)CC2=O |
| InChI | InChI=1S/C11H12N2O/c1-6-5-9(14)7-3-2-4-8(10(6)7)11(12)13/h2-4,6H,5H2,1H3,(H3,12,13) |
| InChIKey | HXBLDFVYXVXVDQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|