C18H29NO6 — CID 67800092
(2S,3R,4S,5S,6R)-2-methoxy-6-[[4-(4-methoxyphenyl)butylamino]methyl]oxane-3,4,5-triol (PubChem CID 67800092) has the molecular formula C18H29NO6 and a molecular weight of 355.43 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-methoxy-6-[[4-(4-methoxyphenyl)butylamino]methyl]oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-methoxy-6-[[4-(4-methoxyphenyl)butylamino]methyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 67800092 |
| Molecular Formula | C18H29NO6 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-methoxy-6-[[4-(4-methoxyphenyl)butylamino]methyl]oxane-3,4,5-triol |
| SMILES | COc1ccc(CCCCNC[C@H]2O[C@H](OC)[C@H](O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C18H29NO6/c1-23-13-8-6-12(7-9-13)5-3-4-10-19-11-14-15(20)16(21)17(22)18(24-2)25-14/h6-9,14-22H,3-5,10-11H2,1-2H3/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | OKWKIVZMTNIJOD-SFFUCWETSA-N |
| XLogP | 0.06 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|