C17H25NO3 — CID 67800211
(4aR,10aR)-6-methoxy-9-(1-methoxyethyl)-4-methyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazine (PubChem CID 67800211) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (4aR,10aR)-6-methoxy-9-(1-methoxyethyl)-4-methyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazine.
| Compound Name | (4aR,10aR)-6-methoxy-9-(1-methoxyethyl)-4-methyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazine |
|---|---|
| PubChem CID | 67800211 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (4aR,10aR)-6-methoxy-9-(1-methoxyethyl)-4-methyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazine |
| SMILES | COc1ccc(C(C)OC)c2c1C[C@@H]1[C@@H](C2)OCCN1C |
| InChI | InChI=1S/C17H25NO3/c1-11(19-3)12-5-6-16(20-4)14-9-15-17(10-13(12)14)21-8-7-18(15)2/h5-6,11,15,17H,7-10H2,1-4H3/t11?,15-,17-/m1/s1 |
| InChIKey | KBLQEQLUMYUPQB-UNXNSXALSA-N |
| XLogP | 2.20 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |