C22H25N3O4S — CID 67812875
2-[4-[ethyl-(5-methoxy-1H-indol-3-yl)amino]butyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 67812875) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-[4-[ethyl-(5-methoxy-1H-indol-3-yl)amino]butyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[4-[ethyl-(5-methoxy-1H-indol-3-yl)amino]butyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 67812875 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-[4-[ethyl-(5-methoxy-1H-indol-3-yl)amino]butyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | CCN(CCCCN1C(=O)c2ccccc2S1(=O)=O)c1c[nH]c2ccc(OC)cc12 |
| InChI | InChI=1S/C22H25N3O4S/c1-3-24(20-15-23-19-11-10-16(29-2)14-18(19)20)12-6-7-13-25-22(26)17-8-4-5-9-21(17)30(25,27)28/h4-5,8-11,14-15,23H,3,6-7,12-13H2,1-2H3 |
| InChIKey | MBQLYEXQZZVREB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|