C24H43N5O3 — CID 67813469
1-[1-(hexylamino)-10-hydroxyundecyl]-3,7-dimethylpurine-2,6-dione (PubChem CID 67813469) has the molecular formula C24H43N5O3 and a molecular weight of 449.64 g/mol. Its IUPAC name is 1-[1-(hexylamino)-10-hydroxyundecyl]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[1-(hexylamino)-10-hydroxyundecyl]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 67813469 |
| Molecular Formula | C24H43N5O3 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.34 |
| IUPAC Name | 1-[1-(hexylamino)-10-hydroxyundecyl]-3,7-dimethylpurine-2,6-dione |
| SMILES | CCCCCCNC(CCCCCCCCC(C)O)n1c(=O)c2c(ncn2C)n(C)c1=O |
| InChI | InChI=1S/C24H43N5O3/c1-5-6-7-14-17-25-20(16-13-11-9-8-10-12-15-19(2)30)29-23(31)21-22(26-18-27(21)3)28(4)24(29)32/h18-20,25,30H,5-17H2,1-4H3 |
| InChIKey | XQDCCRBYVVDRCE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|