C32H56O5Si4 — CID 67819917
2-methylprop-2-enoic acid;triethyl-[ethyl-(ethyl-phenyl-triethylsilyloxysilyl)oxy-phenylsilyl]oxysilane (PubChem CID 67819917) has the molecular formula C32H56O5Si4 and a molecular weight of 633.14 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;triethyl-[ethyl-(ethyl-phenyl-triethylsilyloxysilyl)oxy-phenylsilyl]oxysilane.
| Compound Name | 2-methylprop-2-enoic acid;triethyl-[ethyl-(ethyl-phenyl-triethylsilyloxysilyl)oxy-phenylsilyl]oxysilane |
|---|---|
| PubChem CID | 67819917 |
| Molecular Formula | C32H56O5Si4 |
| Molecular Weight | 633.14 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | 2-methylprop-2-enoic acid;triethyl-[ethyl-(ethyl-phenyl-triethylsilyloxysilyl)oxy-phenylsilyl]oxysilane |
| SMILES | C=C(C)C(=O)O.CC[Si](CC)(CC)O[Si](CC)(O[Si](CC)(O[Si](CC)(CC)CC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H50O3Si4.C4H6O2/c1-9-32(10-2,11-3)29-34(15-7,27-23-19-17-20-24-27)31-35(16-8,28-25-21-18-22-26-28)30-33(12-4,13-5)14-6;1-3(2)4(5)6/h17-26H,9-16H2,1-8H3;1H2,2H3,(H,5,6) |
| InChIKey | JQHSQLFQKOQGDG-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.14 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|