C10H19NOS — CID 67822610
2,8-dimethyl-1λ4-thia-8-azaspiro[4.5]decane 1-oxide (PubChem CID 67822610) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is 2,8-dimethyl-1λ4-thia-8-azaspiro[4.5]decane 1-oxide.
| Compound Name | 2,8-dimethyl-1λ4-thia-8-azaspiro[4.5]decane 1-oxide |
|---|---|
| PubChem CID | 67822610 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2,8-dimethyl-1λ4-thia-8-azaspiro[4.5]decane 1-oxide |
| SMILES | CC1CCC2(CCN(C)CC2)S1=O |
| InChI | InChI=1S/C10H19NOS/c1-9-3-4-10(13(9)12)5-7-11(2)8-6-10/h9H,3-8H2,1-2H3 |
| InChIKey | GRHVKKCLSXTKKU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |