C24H32N3OS+ — CID 67827139
10-[(2R)-1-(1-methylpyrrolidin-1-ium-1-yl)propan-2-yl]-N-propylphenothiazine-2-carboxamide (PubChem CID 67827139) has the molecular formula C24H32N3OS+ and a molecular weight of 410.61 g/mol. Its IUPAC name is 10-[(2R)-1-(1-methylpyrrolidin-1-ium-1-yl)propan-2-yl]-N-propylphenothiazine-2-carboxamide.
| Compound Name | 10-[(2R)-1-(1-methylpyrrolidin-1-ium-1-yl)propan-2-yl]-N-propylphenothiazine-2-carboxamide |
|---|---|
| PubChem CID | 67827139 |
| Molecular Formula | C24H32N3OS+ |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 10-[(2R)-1-(1-methylpyrrolidin-1-ium-1-yl)propan-2-yl]-N-propylphenothiazine-2-carboxamide |
| SMILES | CCCNC(=O)c1ccc2c(c1)N([C@H](C)C[N+]1(C)CCCC1)c1ccccc1S2 |
| InChI | InChI=1S/C24H31N3OS/c1-4-13-25-24(28)19-11-12-23-21(16-19)26(20-9-5-6-10-22(20)29-23)18(2)17-27(3)14-7-8-15-27/h5-6,9-12,16,18H,4,7-8,13-15,17H2,1-3H3/p+1/t18-/m1/s1 |
| InChIKey | ALRXRNOHEGQWSE-GOSISDBHSA-O |
| XLogP | 5.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|