C22H31N4+ — CID 67827433
1-ethyl-N-(6-phenyl-5-propylpyridazin-3-yl)-1-azoniabicyclo[3.2.1]octan-2-amine (PubChem CID 67827433) has the molecular formula C22H31N4+ and a molecular weight of 351.52 g/mol. Its IUPAC name is 1-ethyl-N-(6-phenyl-5-propylpyridazin-3-yl)-1-azoniabicyclo[3.2.1]octan-2-amine.
| Compound Name | 1-ethyl-N-(6-phenyl-5-propylpyridazin-3-yl)-1-azoniabicyclo[3.2.1]octan-2-amine |
|---|---|
| PubChem CID | 67827433 |
| Molecular Formula | C22H31N4+ |
| Molecular Weight | 351.52 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | 1-ethyl-N-(6-phenyl-5-propylpyridazin-3-yl)-1-azoniabicyclo[3.2.1]octan-2-amine |
| SMILES | CCCc1cc(NC2CCC3CC[N+]2(CC)C3)nnc1-c1ccccc1 |
| InChI | InChI=1S/C22H31N4/c1-3-8-19-15-20(24-25-22(19)18-9-6-5-7-10-18)23-21-12-11-17-13-14-26(21,4-2)16-17/h5-7,9-10,15,17,21H,3-4,8,11-14,16H2,1-2H3,(H,23,24)/q+1 |
| InChIKey | QKOUVZWOAWVNLL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|