C22H37O4P — CID 67830229
[(5S,8S,9S,10R,13S,14S,17R)-17-[(2S)-1-hydroxypropan-2-yl]-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid (PubChem CID 67830229) has the molecular formula C22H37O4P and a molecular weight of 396.51 g/mol. Its IUPAC name is [(5S,8S,9S,10R,13S,14S,17R)-17-[(2S)-1-hydroxypropan-2-yl]-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid.
| Compound Name | [(5S,8S,9S,10R,13S,14S,17R)-17-[(2S)-1-hydroxypropan-2-yl]-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 67830229 |
| Molecular Formula | C22H37O4P |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | [(5S,8S,9S,10R,13S,14S,17R)-17-[(2S)-1-hydroxypropan-2-yl]-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid |
| SMILES | C[C@H](CO)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C=C(P(=O)(O)O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H37O4P/c1-14(13-23)18-6-7-19-17-5-4-15-12-16(27(24,25)26)8-10-21(15,2)20(17)9-11-22(18,19)3/h12,14-15,17-20,23H,4-11,13H2,1-3H3,(H2,24,25,26)/t14-,15+,17+,18-,19+,20+,21+,22-/m1/s1 |
| InChIKey | GRSUIVSOTDFXRZ-MLQIOEHVSA-N |
| XLogP | 4.95 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|