C28H51O4PSi — CID 173352730
[(5S,8S,9S,10R,13S,14S,17R)-17-(3-dimethylsilyloxy-4,4-dimethylpentan-2-yl)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid (PubChem CID 173352730) has the molecular formula C28H51O4PSi and a molecular weight of 510.77 g/mol. Its IUPAC name is [(5S,8S,9S,10R,13S,14S,17R)-17-(3-dimethylsilyloxy-4,4-dimethylpentan-2-yl)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid.
| Compound Name | [(5S,8S,9S,10R,13S,14S,17R)-17-(3-dimethylsilyloxy-4,4-dimethylpentan-2-yl)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 173352730 |
| Molecular Formula | C28H51O4PSi |
| Molecular Weight | 510.77 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | [(5S,8S,9S,10R,13S,14S,17R)-17-(3-dimethylsilyloxy-4,4-dimethylpentan-2-yl)-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]phosphonic acid |
| SMILES | CC(C(O[SiH](C)C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C=C(P(=O)(O)O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H51O4PSi/c1-18(25(26(2,3)4)32-34(7)8)22-11-12-23-21-10-9-19-17-20(33(29,30)31)13-15-27(19,5)24(21)14-16-28(22,23)6/h17-19,21-25,34H,9-16H2,1-8H3,(H2,29,30,31)/t18?,19-,21-,22+,23-,24-,25?,27-,28+/m0/s1 |
| InChIKey | OUBOQORNDQJXSL-ZECKALGTSA-N |
| XLogP | 7.37 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.77 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|