C21H33O4P — CID 18640508
[(5S,8R,9S,10R,13S,14S,17S)-17-formyl-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-methoxyphosphinic acid (PubChem CID 18640508) has the molecular formula C21H33O4P and a molecular weight of 380.47 g/mol. Its IUPAC name is [(5S,8R,9S,10R,13S,14S,17S)-17-formyl-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-methoxyphosphinic acid.
| Compound Name | [(5S,8R,9S,10R,13S,14S,17S)-17-formyl-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-methoxyphosphinic acid |
|---|---|
| PubChem CID | 18640508 |
| Molecular Formula | C21H33O4P |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [(5S,8R,9S,10R,13S,14S,17S)-17-formyl-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-methoxyphosphinic acid |
| SMILES | COP(=O)(O)C1=C[C@@H]2CC[C@@H]3[C@H](CC[C@]4(C)[C@@H](C=O)CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C21H33O4P/c1-20-10-8-16(26(23,24)25-3)12-14(20)4-6-17-18-7-5-15(13-22)21(18,2)11-9-19(17)20/h12-15,17-19H,4-11H2,1-3H3,(H,23,24)/t14-,15+,17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | GEBDMELJTPXJNI-QELYCPIFSA-N |
| XLogP | 5.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|