C22H31ClO3 — CID 88514823
methyl (5S,10R,13S)-17-carbonochloridoyl-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate (PubChem CID 88514823) has the molecular formula C22H31ClO3 and a molecular weight of 378.94 g/mol. Its IUPAC name is methyl (5S,10R,13S)-17-carbonochloridoyl-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate.
| Compound Name | methyl (5S,10R,13S)-17-carbonochloridoyl-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate |
|---|---|
| PubChem CID | 88514823 |
| Molecular Formula | C22H31ClO3 |
| Molecular Weight | 378.94 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | methyl (5S,10R,13S)-17-carbonochloridoyl-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate |
| SMILES | COC(=O)C1=C[C@@H]2CCC3C4CCC(C(=O)Cl)[C@@]4(C)CCC3[C@@]2(C)CC1 |
| InChI | InChI=1S/C22H31ClO3/c1-21-10-8-13(20(25)26-3)12-14(21)4-5-15-16-6-7-18(19(23)24)22(16,2)11-9-17(15)21/h12,14-18H,4-11H2,1-3H3/t14-,15?,16?,17?,18?,21-,22-/m0/s1 |
| InChIKey | MSZJRNNIJLFREW-MPFQOFCXSA-N |
| XLogP | 5.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.94 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|