C28H48O3Si — CID 57050466
methyl (8R,9R,10R,13S,14S)-17-[[tert-butyl(dimethyl)silyl]oxymethyl]-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate (PubChem CID 57050466) has the molecular formula C28H48O3Si and a molecular weight of 460.78 g/mol. Its IUPAC name is methyl (8R,9R,10R,13S,14S)-17-[[tert-butyl(dimethyl)silyl]oxymethyl]-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate.
| Compound Name | methyl (8R,9R,10R,13S,14S)-17-[[tert-butyl(dimethyl)silyl]oxymethyl]-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate |
|---|---|
| PubChem CID | 57050466 |
| Molecular Formula | C28H48O3Si |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 460.34 |
| IUPAC Name | methyl (8R,9R,10R,13S,14S)-17-[[tert-butyl(dimethyl)silyl]oxymethyl]-10,13-dimethyl-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3-carboxylate |
| SMILES | COC(=O)C1=CC2CC[C@@H]3[C@@H](CC[C@]4(C)C(CO[Si](C)(C)C(C)(C)C)CC[C@@H]34)[C@@]2(C)CC1 |
| InChI | InChI=1S/C28H48O3Si/c1-26(2,3)32(7,8)31-18-21-10-12-23-22-11-9-20-17-19(25(29)30-6)13-15-27(20,4)24(22)14-16-28(21,23)5/h17,20-24H,9-16,18H2,1-8H3/t20?,21?,22-,23-,24+,27-,28+/m0/s1 |
| InChIKey | HATDKXJYOFDOQD-SUZIHONPSA-N |
| XLogP | 7.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|