C16H15ClO5 — CID 67830528
[(1S,6R)-6-[3-(4-chlorophenyl)-3-oxopropanoyl]cyclohex-3-en-1-yl] hydrogen carbonate (PubChem CID 67830528) has the molecular formula C16H15ClO5 and a molecular weight of 322.74 g/mol. Its IUPAC name is [(1S,6R)-6-[3-(4-chlorophenyl)-3-oxopropanoyl]cyclohex-3-en-1-yl] hydrogen carbonate.
| Compound Name | [(1S,6R)-6-[3-(4-chlorophenyl)-3-oxopropanoyl]cyclohex-3-en-1-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 67830528 |
| Molecular Formula | C16H15ClO5 |
| Molecular Weight | 322.74 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | [(1S,6R)-6-[3-(4-chlorophenyl)-3-oxopropanoyl]cyclohex-3-en-1-yl] hydrogen carbonate |
| SMILES | O=C(O)O[C@H]1CC=CC[C@H]1C(=O)CC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15ClO5/c17-11-7-5-10(6-8-11)13(18)9-14(19)12-3-1-2-4-15(12)22-16(20)21/h1-2,5-8,12,15H,3-4,9H2,(H,20,21)/t12-,15-/m0/s1 |
| InChIKey | KGHHTNNBUUXXDO-WFASDCNBSA-N |
| XLogP | 3.51 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.74 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|