C24H20Cl2O6 — CID 1217354
bis[2-(4-chlorophenyl)-2-oxoethyl] (1S,2S)-cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 1217354) has the molecular formula C24H20Cl2O6 and a molecular weight of 475.32 g/mol. Its IUPAC name is bis[2-(4-chlorophenyl)-2-oxoethyl] (1S,2S)-cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | bis[2-(4-chlorophenyl)-2-oxoethyl] (1S,2S)-cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 1217354 |
| Molecular Formula | C24H20Cl2O6 |
| Molecular Weight | 475.32 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | bis[2-(4-chlorophenyl)-2-oxoethyl] (1S,2S)-cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | O=C(COC(=O)[C@H]1CC=CC[C@@H]1C(=O)OCC(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H20Cl2O6/c25-17-9-5-15(6-10-17)21(27)13-31-23(29)19-3-1-2-4-20(19)24(30)32-14-22(28)16-7-11-18(26)12-8-16/h1-2,5-12,19-20H,3-4,13-14H2/t19-,20-/m0/s1 |
| InChIKey | TVNOPUPNFVVPJF-PMACEKPBSA-N |
| XLogP | 4.73 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|