C26H23NO4 — CID 67834551
benzyl 4-[2-(4-hydroxybenzoyl)-1H-indol-3-yl]butanoate (PubChem CID 67834551) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is benzyl 4-[2-(4-hydroxybenzoyl)-1H-indol-3-yl]butanoate.
| Compound Name | benzyl 4-[2-(4-hydroxybenzoyl)-1H-indol-3-yl]butanoate |
|---|---|
| PubChem CID | 67834551 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | benzyl 4-[2-(4-hydroxybenzoyl)-1H-indol-3-yl]butanoate |
| SMILES | O=C(CCCc1c(C(=O)c2ccc(O)cc2)[nH]c2ccccc12)OCc1ccccc1 |
| InChI | InChI=1S/C26H23NO4/c28-20-15-13-19(14-16-20)26(30)25-22(21-9-4-5-11-23(21)27-25)10-6-12-24(29)31-17-18-7-2-1-3-8-18/h1-5,7-9,11,13-16,27-28H,6,10,12,17H2 |
| InChIKey | KECNPZFURHUBGL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|