C15H17NO4S2 — CID 67836859
3-methoxyprop-2-enoic acid;2-methylsulfanyl-4-(phenoxymethyl)-1,3-thiazole (PubChem CID 67836859) has the molecular formula C15H17NO4S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 3-methoxyprop-2-enoic acid;2-methylsulfanyl-4-(phenoxymethyl)-1,3-thiazole.
| Compound Name | 3-methoxyprop-2-enoic acid;2-methylsulfanyl-4-(phenoxymethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 67836859 |
| Molecular Formula | C15H17NO4S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 3-methoxyprop-2-enoic acid;2-methylsulfanyl-4-(phenoxymethyl)-1,3-thiazole |
| SMILES | COC=CC(=O)O.CSc1nc(COc2ccccc2)cs1 |
| InChI | InChI=1S/C11H11NOS2.C4H6O3/c1-14-11-12-9(8-15-11)7-13-10-5-3-2-4-6-10;1-7-3-2-4(5)6/h2-6,8H,7H2,1H3;2-3H,1H3,(H,5,6) |
| InChIKey | NOIYCNOMXNPEBV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|