C53H56N2O3 — CID 67847743
4-[[2-[bis[[4-hydroxy-3-methyl-5-[(E)-2-(2-methylphenyl)ethenyl]phenyl]methyl]amino]ethylamino]methyl]-2-methyl-6-[(E)-2-(2-methylphenyl)ethenyl]phenol (PubChem CID 67847743) has the molecular formula C53H56N2O3 and a molecular weight of 769.04 g/mol. Its IUPAC name is 4-[[2-[bis[[4-hydroxy-3-methyl-5-[(E)-2-(2-methylphenyl)ethenyl]phenyl]methyl]amino]ethylamino]methyl]-2-methyl-6-[(E)-2-(2-methylphenyl)ethenyl]phenol.
| Compound Name | 4-[[2-[bis[[4-hydroxy-3-methyl-5-[(E)-2-(2-methylphenyl)ethenyl]phenyl]methyl]amino]ethylamino]methyl]-2-methyl-6-[(E)-2-(2-methylphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 67847743 |
| Molecular Formula | C53H56N2O3 |
| Molecular Weight | 769.04 g/mol |
| Exact Mass | 768.43 |
| IUPAC Name | 4-[[2-[bis[[4-hydroxy-3-methyl-5-[(E)-2-(2-methylphenyl)ethenyl]phenyl]methyl]amino]ethylamino]methyl]-2-methyl-6-[(E)-2-(2-methylphenyl)ethenyl]phenol |
| SMILES | Cc1ccccc1/C=C/c1cc(CNCCN(Cc2cc(C)c(O)c(/C=C/c3ccccc3C)c2)Cc2cc(C)c(O)c(/C=C/c3ccccc3C)c2)cc(C)c1O |
| InChI | InChI=1S/C53H56N2O3/c1-36-13-7-10-16-45(36)19-22-48-30-42(27-39(4)51(48)56)33-54-25-26-55(34-43-28-40(5)52(57)49(31-43)23-20-46-17-11-8-14-37(46)2)35-44-29-41(6)53(58)50(32-44)24-21-47-18-12-9-15-38(47)3/h7-24,27-32,54,56-58H,25-26,33-35H2,1-6H3/b22-19+,23-20+,24-21+ |
| InChIKey | BUINPHSHXHRVHB-IKVQWSBMSA-N |
| XLogP | 11.96 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.04 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|