C23H34N2O3Si — CID 67849190
benzyl (E)-3-[2-butyl-3-[ethoxy(trimethylsilyl)methyl]imidazol-4-yl]prop-2-enoate (PubChem CID 67849190) has the molecular formula C23H34N2O3Si and a molecular weight of 414.62 g/mol. Its IUPAC name is benzyl (E)-3-[2-butyl-3-[ethoxy(trimethylsilyl)methyl]imidazol-4-yl]prop-2-enoate.
| Compound Name | benzyl (E)-3-[2-butyl-3-[ethoxy(trimethylsilyl)methyl]imidazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67849190 |
| Molecular Formula | C23H34N2O3Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | benzyl (E)-3-[2-butyl-3-[ethoxy(trimethylsilyl)methyl]imidazol-4-yl]prop-2-enoate |
| SMILES | CCCCc1ncc(/C=C/C(=O)OCc2ccccc2)n1C(OCC)[Si](C)(C)C |
| InChI | InChI=1S/C23H34N2O3Si/c1-6-8-14-21-24-17-20(25(21)23(27-7-2)29(3,4)5)15-16-22(26)28-18-19-12-10-9-11-13-19/h9-13,15-17,23H,6-8,14,18H2,1-5H3/b16-15+ |
| InChIKey | XQJAMHQKCCNTKB-FOCLMDBBSA-N |
| XLogP | 5.39 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|