C25H39N2O3SSi- — CID 19936855
(E)-3-[2-butyl-3-[ethoxy(trimethylsilyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)hept-2-enoate (PubChem CID 19936855) has the molecular formula C25H39N2O3SSi- and a molecular weight of 475.75 g/mol. Its IUPAC name is (E)-3-[2-butyl-3-[ethoxy(trimethylsilyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)hept-2-enoate.
| Compound Name | (E)-3-[2-butyl-3-[ethoxy(trimethylsilyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)hept-2-enoate |
|---|---|
| PubChem CID | 19936855 |
| Molecular Formula | C25H39N2O3SSi- |
| Molecular Weight | 475.75 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | (E)-3-[2-butyl-3-[ethoxy(trimethylsilyl)methyl]imidazol-4-yl]-2-(thiophen-2-ylmethyl)hept-2-enoate |
| SMILES | CCCC/C(=C(/Cc1cccs1)C(=O)[O-])c1cnc(CCCC)n1C(OCC)[Si](C)(C)C |
| InChI | InChI=1S/C25H40N2O3SSi/c1-7-10-14-20(21(24(28)29)17-19-13-12-16-31-19)22-18-26-23(15-11-8-2)27(22)25(30-9-3)32(4,5)6/h12-13,16,18,25H,7-11,14-15,17H2,1-6H3,(H,28,29)/p-1/b21-20+ |
| InChIKey | PDXBRFLVIANLHS-QZQOTICOSA-M |
| XLogP | 5.64 |
| TPSA | 67.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.75 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|