C20H20ClNO — CID 67850128
N-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]but-2-en-1-amine (PubChem CID 67850128) has the molecular formula C20H20ClNO and a molecular weight of 325.84 g/mol. Its IUPAC name is N-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]but-2-en-1-amine.
| Compound Name | N-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]but-2-en-1-amine |
|---|---|
| PubChem CID | 67850128 |
| Molecular Formula | C20H20ClNO |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[[3-(4-chlorophenyl)-5-methyl-1-benzofuran-2-yl]methyl]but-2-en-1-amine |
| SMILES | CC=CCNCc1oc2ccc(C)cc2c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClNO/c1-3-4-11-22-13-19-20(15-6-8-16(21)9-7-15)17-12-14(2)5-10-18(17)23-19/h3-10,12,22H,11,13H2,1-2H3 |
| InChIKey | OQKNQAACJRJURI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|