C20H19NO4 — CID 67850729
(3R,4R)-4-benzoyl-3-(1-hydroxyethyl)-1-phenacylazetidin-2-one (PubChem CID 67850729) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is (3R,4R)-4-benzoyl-3-(1-hydroxyethyl)-1-phenacylazetidin-2-one.
| Compound Name | (3R,4R)-4-benzoyl-3-(1-hydroxyethyl)-1-phenacylazetidin-2-one |
|---|---|
| PubChem CID | 67850729 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (3R,4R)-4-benzoyl-3-(1-hydroxyethyl)-1-phenacylazetidin-2-one |
| SMILES | CC(O)[C@@H]1C(=O)N(CC(=O)c2ccccc2)[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19NO4/c1-13(22)17-18(19(24)15-10-6-3-7-11-15)21(20(17)25)12-16(23)14-8-4-2-5-9-14/h2-11,13,17-18,22H,12H2,1H3/t13?,17-,18+/m0/s1 |
| InChIKey | GAFSIFMUQQQQJN-UGGKNOJYSA-N |
| XLogP | 1.96 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |