C19H18N4O3 — CID 67853578
[(E)-1-(1H-indol-3-yl)-3-oxo-3-(2-pyridin-2-ylethylamino)prop-1-en-2-yl]carbamic acid (PubChem CID 67853578) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is [(E)-1-(1H-indol-3-yl)-3-oxo-3-(2-pyridin-2-ylethylamino)prop-1-en-2-yl]carbamic acid.
| Compound Name | [(E)-1-(1H-indol-3-yl)-3-oxo-3-(2-pyridin-2-ylethylamino)prop-1-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67853578 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | [(E)-1-(1H-indol-3-yl)-3-oxo-3-(2-pyridin-2-ylethylamino)prop-1-en-2-yl]carbamic acid |
| SMILES | O=C(O)N/C(=C/c1c[nH]c2ccccc12)C(=O)NCCc1ccccn1 |
| InChI | InChI=1S/C19H18N4O3/c24-18(21-10-8-14-5-3-4-9-20-14)17(23-19(25)26)11-13-12-22-16-7-2-1-6-15(13)16/h1-7,9,11-12,22-23H,8,10H2,(H,21,24)(H,25,26)/b17-11+ |
| InChIKey | HIVKUHGGBVYTRB-GZTJUZNOSA-N |
| XLogP | 2.53 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|