C12H14N2O6 — CID 67860221
1-[(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl]-5-prop-1-ynylpyrimidine-2,4-dione (PubChem CID 67860221) has the molecular formula C12H14N2O6 and a molecular weight of 282.25 g/mol. Its IUPAC name is 1-[(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl]-5-prop-1-ynylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl]-5-prop-1-ynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67860221 |
| Molecular Formula | C12H14N2O6 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-[(2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)oxolan-3-yl]-5-prop-1-ynylpyrimidine-2,4-dione |
| SMILES | CC#Cc1cn([C@@]2(O)[C@H](O)CO[C@@H]2CO)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H14N2O6/c1-2-3-7-4-14(11(18)13-10(7)17)12(19)8(16)6-20-9(12)5-15/h4,8-9,15-16,19H,5-6H2,1H3,(H,13,17,18)/t8-,9-,12-/m1/s1 |
| InChIKey | YFWRQMGSMDCQSL-KBVBSXBZSA-N |
| XLogP | -2.69 |
| TPSA | 124.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|