C13H17N3O5 — CID 163825208
5-(3-aminoprop-1-ynyl)-1-[(2S)-4-hydroxy-5-(hydroxymethyl)-2-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 163825208) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-1-[(2S)-4-hydroxy-5-(hydroxymethyl)-2-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-(3-aminoprop-1-ynyl)-1-[(2S)-4-hydroxy-5-(hydroxymethyl)-2-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163825208 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-1-[(2S)-4-hydroxy-5-(hydroxymethyl)-2-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C[C@@]1(n2cc(C#CCN)c(=O)[nH]c2=O)CC(O)C(CO)O1 |
| InChI | InChI=1S/C13H17N3O5/c1-13(5-9(18)10(7-17)21-13)16-6-8(3-2-4-14)11(19)15-12(16)20/h6,9-10,17-18H,4-5,7,14H2,1H3,(H,15,19,20)/t9?,10?,13-/m0/s1 |
| InChIKey | NYWKCWBMZOKTSN-ZPPKWKGLSA-N |
| XLogP | -2.34 |
| TPSA | 130.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|