C21H27N3O8 — CID 161162374
5-[(1S)-2,2-dimethyl-1-(2-nitrophenyl)propoxy]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 161162374) has the molecular formula C21H27N3O8 and a molecular weight of 449.46 g/mol. Its IUPAC name is 5-[(1S)-2,2-dimethyl-1-(2-nitrophenyl)propoxy]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-[(1S)-2,2-dimethyl-1-(2-nitrophenyl)propoxy]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 161162374 |
| Molecular Formula | C21H27N3O8 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 5-[(1S)-2,2-dimethyl-1-(2-nitrophenyl)propoxy]-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-2-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[C@H](Oc1cn([C@@]2(C)C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H27N3O8/c1-20(2,3)17(12-7-5-6-8-13(12)24(29)30)31-15-10-23(19(28)22-18(15)27)21(4)9-14(26)16(11-25)32-21/h5-8,10,14,16-17,25-26H,9,11H2,1-4H3,(H,22,27,28)/t14-,16+,17+,21+/m0/s1 |
| InChIKey | UQBWTPCAMNBKAI-CTRXZIQJSA-N |
| XLogP | 1.43 |
| TPSA | 156.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|