C6H13NO4 — CID 67860397
(2S,3S,4S)-1,2-bis(hydroxymethyl)pyrrolidine-3,4-diol (PubChem CID 67860397) has the molecular formula C6H13NO4 and a molecular weight of 163.17 g/mol. Its IUPAC name is (2S,3S,4S)-1,2-bis(hydroxymethyl)pyrrolidine-3,4-diol.
| Compound Name | (2S,3S,4S)-1,2-bis(hydroxymethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 67860397 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (2S,3S,4S)-1,2-bis(hydroxymethyl)pyrrolidine-3,4-diol |
| SMILES | OC[C@H]1[C@H](O)[C@@H](O)CN1CO |
| InChI | InChI=1S/C6H13NO4/c8-2-4-6(11)5(10)1-7(4)3-9/h4-6,8-11H,1-3H2/t4-,5-,6-/m0/s1 |
| InChIKey | NDLMGGQMGXWZPT-ZLUOBGJFSA-N |
| XLogP | -2.67 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |