C23H25NO4 — CID 67863216
(2S)-1-[3-[2-[(E)-2-phenylethenyl]phenoxy]butanoyl]pyrrolidine-2-carboxylic acid (PubChem CID 67863216) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2S)-1-[3-[2-[(E)-2-phenylethenyl]phenoxy]butanoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[3-[2-[(E)-2-phenylethenyl]phenoxy]butanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67863216 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | (2S)-1-[3-[2-[(E)-2-phenylethenyl]phenoxy]butanoyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(CC(=O)N1CCC[C@H]1C(=O)O)Oc1ccccc1/C=C/c1ccccc1 |
| InChI | InChI=1S/C23H25NO4/c1-17(16-22(25)24-15-7-11-20(24)23(26)27)28-21-12-6-5-10-19(21)14-13-18-8-3-2-4-9-18/h2-6,8-10,12-14,17,20H,7,11,15-16H2,1H3,(H,26,27)/b14-13+/t17?,20-/m0/s1 |
| InChIKey | NMMOJYHENSBGPC-DBJFEGIHSA-N |
| XLogP | 4.09 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|