C20H24N2O6S — CID 67866063
[5-(2-phenylmethoxyethylsulfonylcarbamoyl)-2-pyridinyl]methyl butanoate (PubChem CID 67866063) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is [5-(2-phenylmethoxyethylsulfonylcarbamoyl)-2-pyridinyl]methyl butanoate.
| Compound Name | [5-(2-phenylmethoxyethylsulfonylcarbamoyl)-2-pyridinyl]methyl butanoate |
|---|---|
| PubChem CID | 67866063 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | [5-(2-phenylmethoxyethylsulfonylcarbamoyl)-2-pyridinyl]methyl butanoate |
| SMILES | CCCC(=O)OCc1ccc(C(=O)NS(=O)(=O)CCOCc2ccccc2)cn1 |
| InChI | InChI=1S/C20H24N2O6S/c1-2-6-19(23)28-15-18-10-9-17(13-21-18)20(24)22-29(25,26)12-11-27-14-16-7-4-3-5-8-16/h3-5,7-10,13H,2,6,11-12,14-15H2,1H3,(H,22,24) |
| InChIKey | OGRSVHOKLBMCMZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|