C9H16N2 — CID 67867374
1-azatricyclo[4.3.1.03,7]decan-8-amine (PubChem CID 67867374) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-azatricyclo[4.3.1.03,7]decan-8-amine.
| Compound Name | 1-azatricyclo[4.3.1.03,7]decan-8-amine |
|---|---|
| PubChem CID | 67867374 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1-azatricyclo[4.3.1.03,7]decan-8-amine |
| SMILES | NC1CN2CC3CCC(C2)C13 |
| InChI | InChI=1S/C9H16N2/c10-8-5-11-3-6-1-2-7(4-11)9(6)8/h6-9H,1-5,10H2 |
| InChIKey | SZJBMQJWNLNBBX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |