C34H42O — CID 67870384
(8R,9R,10R,13S,14S)-10-[(4-ethyl-1H-phenalen-1-yl)methyl]-13-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 67870384) has the molecular formula C34H42O and a molecular weight of 466.71 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-10-[(4-ethyl-1H-phenalen-1-yl)methyl]-13-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9R,10R,13S,14S)-10-[(4-ethyl-1H-phenalen-1-yl)methyl]-13-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 67870384 |
| Molecular Formula | C34H42O |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.32 |
| IUPAC Name | (8R,9R,10R,13S,14S)-10-[(4-ethyl-1H-phenalen-1-yl)methyl]-13-methyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CCc1ccc2cccc3c2c1C=CC3C[C@]12CCCCC1CC[C@@H]1[C@H]2CC[C@]2(C)C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C34H42O/c1-3-22-10-11-23-7-6-9-26-24(12-14-27(22)32(23)26)21-34-19-5-4-8-25(34)13-15-28-29-16-17-31(35)33(29,2)20-18-30(28)34/h6-7,9-12,14,24-25,28-30H,3-5,8,13,15-21H2,1-2H3/t24?,25?,28-,29-,30+,33-,34+/m0/s1 |
| InChIKey | MKKNHVLGZVRTFQ-SBVCAVSRSA-N |
| XLogP | 8.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |