C14H13FO4 — CID 67871209
6-fluoro-2'-oxospiro[2,3-dihydrochromene-4,3'-cyclopentane]-1'-carboxylic acid (PubChem CID 67871209) has the molecular formula C14H13FO4 and a molecular weight of 264.25 g/mol. Its IUPAC name is 6-fluoro-2'-oxospiro[2,3-dihydrochromene-4,3'-cyclopentane]-1'-carboxylic acid.
| Compound Name | 6-fluoro-2'-oxospiro[2,3-dihydrochromene-4,3'-cyclopentane]-1'-carboxylic acid |
|---|---|
| PubChem CID | 67871209 |
| Molecular Formula | C14H13FO4 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 6-fluoro-2'-oxospiro[2,3-dihydrochromene-4,3'-cyclopentane]-1'-carboxylic acid |
| SMILES | O=C(O)C1CCC2(CCOc3ccc(F)cc32)C1=O |
| InChI | InChI=1S/C14H13FO4/c15-8-1-2-11-10(7-8)14(5-6-19-11)4-3-9(12(14)16)13(17)18/h1-2,7,9H,3-6H2,(H,17,18) |
| InChIKey | YZPNEFSQWOFFPO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|