C25H25ClN2O4S — CID 67873137
ethyl 3-[4-[2-[(4-chlorophenyl)sulfonylamino]-2-pyridin-3-ylethyl]-3-methylphenyl]prop-2-enoate (PubChem CID 67873137) has the molecular formula C25H25ClN2O4S and a molecular weight of 485.01 g/mol. Its IUPAC name is ethyl 3-[4-[2-[(4-chlorophenyl)sulfonylamino]-2-pyridin-3-ylethyl]-3-methylphenyl]prop-2-enoate.
| Compound Name | ethyl 3-[4-[2-[(4-chlorophenyl)sulfonylamino]-2-pyridin-3-ylethyl]-3-methylphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 67873137 |
| Molecular Formula | C25H25ClN2O4S |
| Molecular Weight | 485.01 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | ethyl 3-[4-[2-[(4-chlorophenyl)sulfonylamino]-2-pyridin-3-ylethyl]-3-methylphenyl]prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(CC(NS(=O)(=O)c2ccc(Cl)cc2)c2cccnc2)c(C)c1 |
| InChI | InChI=1S/C25H25ClN2O4S/c1-3-32-25(29)13-7-19-6-8-20(18(2)15-19)16-24(21-5-4-14-27-17-21)28-33(30,31)23-11-9-22(26)10-12-23/h4-15,17,24,28H,3,16H2,1-2H3 |
| InChIKey | SURNEEVRZQIEGL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.01 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|