C23H26N2O3 — CID 67875763
5-[2-[methyl-[[(6R)-6,7,8,9-tetrahydrobenzo[g][1,3]benzodioxol-6-yl]methyl]amino]ethyl]-1,3-dihydroindol-2-one (PubChem CID 67875763) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 5-[2-[methyl-[[(6R)-6,7,8,9-tetrahydrobenzo[g][1,3]benzodioxol-6-yl]methyl]amino]ethyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-[methyl-[[(6R)-6,7,8,9-tetrahydrobenzo[g][1,3]benzodioxol-6-yl]methyl]amino]ethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 67875763 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 5-[2-[methyl-[[(6R)-6,7,8,9-tetrahydrobenzo[g][1,3]benzodioxol-6-yl]methyl]amino]ethyl]-1,3-dihydroindol-2-one |
| SMILES | CN(CCc1ccc2c(c1)CC(=O)N2)C[C@@H]1CCCc2c1ccc1c2OCO1 |
| InChI | InChI=1S/C23H26N2O3/c1-25(10-9-15-5-7-20-17(11-15)12-22(26)24-20)13-16-3-2-4-19-18(16)6-8-21-23(19)28-14-27-21/h5-8,11,16H,2-4,9-10,12-14H2,1H3,(H,24,26)/t16-/m0/s1 |
| InChIKey | NCRVQMCQFKOTJP-INIZCTEOSA-N |
| XLogP | 3.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |