C22H21Cl2NO3 — CID 67879435
(S)-chloro-(2-chlorophenyl)-[2-[(2,4-dimethoxyphenyl)methylamino]phenyl]methanol (PubChem CID 67879435) has the molecular formula C22H21Cl2NO3 and a molecular weight of 418.32 g/mol. Its IUPAC name is (S)-chloro-(2-chlorophenyl)-[2-[(2,4-dimethoxyphenyl)methylamino]phenyl]methanol.
| Compound Name | (S)-chloro-(2-chlorophenyl)-[2-[(2,4-dimethoxyphenyl)methylamino]phenyl]methanol |
|---|---|
| PubChem CID | 67879435 |
| Molecular Formula | C22H21Cl2NO3 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | (S)-chloro-(2-chlorophenyl)-[2-[(2,4-dimethoxyphenyl)methylamino]phenyl]methanol |
| SMILES | COc1ccc(CNc2ccccc2[C@](O)(Cl)c2ccccc2Cl)c(OC)c1 |
| InChI | InChI=1S/C22H21Cl2NO3/c1-27-16-12-11-15(21(13-16)28-2)14-25-20-10-6-4-8-18(20)22(24,26)17-7-3-5-9-19(17)23/h3-13,25-26H,14H2,1-2H3/t22-/m0/s1 |
| InChIKey | FJENFRUHKGHULH-QFIPXVFZSA-N |
| XLogP | 5.40 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|