About 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid
7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid (PubChem CID 67880098) has the molecular formula C17H11FN2O3S
and a molecular weight of 342.35 g/mol. Its IUPAC name is 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid |
| PubChem CID | 67880098 |
| Molecular Formula | C17H11FN2O3S |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid |
| SMILES | Nc1ccc(-c2cc3c(cc2F)c(=O)c(C(=O)O)c2n3CS2)cc1 |
| InChI | InChI=1S/C17H11FN2O3S/c18-12-5-11-13(6-10(12)8-1-3-9(19)4-2-8)20-7-24-16(20)14(15(11)21)17(22)23/h1-6H,7,19H2,(H,22,23) |
| InChIKey | UENDMKNDDQEVFU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid?
The IUPAC name of 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid (CID 67880098) is 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid.
What is the SMILES notation for 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid?
The canonical SMILES for 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid is Nc1ccc(-c2cc3c(cc2F)c(=O)c(C(=O)O)c2n3CS2)cc1.
What is the InChIKey of 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid?
The InChIKey is UENDMKNDDQEVFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11FN2O3S/c18-12-5-11-13(6-10(12)8-1-3-9(19)4-2-8)20-7-24-16(20)14(15(11)21)17(22)23/h1-6H,7,19H2,(H,22,23).
What are the key properties of 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid?
7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid has a molecular weight of 342.35 g/mol, XLogP of 3.15, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid is sourced from PubChem (CID 67880098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).