C17H11FN2O3S — CID 67880098
7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid (PubChem CID 67880098) has the molecular formula C17H11FN2O3S and a molecular weight of 342.35 g/mol. Its IUPAC name is 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid.
| Compound Name | 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 67880098 |
| Molecular Formula | C17H11FN2O3S |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 7-(4-aminophenyl)-6-fluoro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid |
| SMILES | Nc1ccc(-c2cc3c(cc2F)c(=O)c(C(=O)O)c2n3CS2)cc1 |
| InChI | InChI=1S/C17H11FN2O3S/c18-12-5-11-13(6-10(12)8-1-3-9(19)4-2-8)20-7-24-16(20)14(15(11)21)17(22)23/h1-6H,7,19H2,(H,22,23) |
| InChIKey | UENDMKNDDQEVFU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|