C21H24N4O5S — CID 86574320
6-nitro-4-oxo-7-(4-piperidin-1-ylpiperidin-1-yl)-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid (PubChem CID 86574320) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is 6-nitro-4-oxo-7-(4-piperidin-1-ylpiperidin-1-yl)-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid.
| Compound Name | 6-nitro-4-oxo-7-(4-piperidin-1-ylpiperidin-1-yl)-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 86574320 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 6-nitro-4-oxo-7-(4-piperidin-1-ylpiperidin-1-yl)-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1c2n(c3cc(N4CCC(N5CCCCC5)CC4)c([N+](=O)[O-])cc3c1=O)CS2 |
| InChI | InChI=1S/C21H24N4O5S/c26-19-14-10-17(25(29)30)16(11-15(14)24-12-31-20(24)18(19)21(27)28)23-8-4-13(5-9-23)22-6-2-1-3-7-22/h10-11,13H,1-9,12H2,(H,27,28) |
| InChIKey | CPGKFCFEAAPNLQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|