C23H18ClN5O6S — CID 86574756
6-[4-(6-chloro-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]-7-nitro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid (PubChem CID 86574756) has the molecular formula C23H18ClN5O6S and a molecular weight of 527.95 g/mol. Its IUPAC name is 6-[4-(6-chloro-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]-7-nitro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid.
| Compound Name | 6-[4-(6-chloro-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]-7-nitro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 86574756 |
| Molecular Formula | C23H18ClN5O6S |
| Molecular Weight | 527.95 g/mol |
| Exact Mass | 527.07 |
| IUPAC Name | 6-[4-(6-chloro-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]-7-nitro-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1c2n(c3cc([N+](=O)[O-])c(N4CCC(n5c(=O)[nH]c6ccc(Cl)cc65)CC4)cc3c1=O)CS2 |
| InChI | InChI=1S/C23H18ClN5O6S/c24-11-1-2-14-16(7-11)28(23(33)25-14)12-3-5-26(6-4-12)17-8-13-15(9-18(17)29(34)35)27-10-36-21(27)19(20(13)30)22(31)32/h1-2,7-9,12H,3-6,10H2,(H,25,33)(H,31,32) |
| InChIKey | ULVGMZKRHZBAFY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 143.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.95 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|