C15H15N3O6 — CID 3361354
2-(5-nitro-1,3-dioxo-6-piperidin-1-ylisoindol-2-yl)acetic acid (PubChem CID 3361354) has the molecular formula C15H15N3O6 and a molecular weight of 333.30 g/mol. Its IUPAC name is 2-(5-nitro-1,3-dioxo-6-piperidin-1-ylisoindol-2-yl)acetic acid.
| Compound Name | 2-(5-nitro-1,3-dioxo-6-piperidin-1-ylisoindol-2-yl)acetic acid |
|---|---|
| PubChem CID | 3361354 |
| Molecular Formula | C15H15N3O6 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-(5-nitro-1,3-dioxo-6-piperidin-1-ylisoindol-2-yl)acetic acid |
| SMILES | O=C(O)CN1C(=O)c2cc(N3CCCCC3)c([N+](=O)[O-])cc2C1=O |
| InChI | InChI=1S/C15H15N3O6/c19-13(20)8-17-14(21)9-6-11(16-4-2-1-3-5-16)12(18(23)24)7-10(9)15(17)22/h6-7H,1-5,8H2,(H,19,20) |
| InChIKey | NSFFLCRRCROHKS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|