C21H15F2NO5 — CID 67880301
(2-benzyl-6,7-difluoro-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,11-pentaen-11-yl) ethyl carbonate (PubChem CID 67880301) has the molecular formula C21H15F2NO5 and a molecular weight of 399.35 g/mol. Its IUPAC name is (2-benzyl-6,7-difluoro-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,11-pentaen-11-yl) ethyl carbonate.
| Compound Name | (2-benzyl-6,7-difluoro-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,11-pentaen-11-yl) ethyl carbonate |
|---|---|
| PubChem CID | 67880301 |
| Molecular Formula | C21H15F2NO5 |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | (2-benzyl-6,7-difluoro-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,11-pentaen-11-yl) ethyl carbonate |
| SMILES | CCOC(=O)Oc1cn2c3c(c(F)c(F)cc3c1=O)OC=C2Cc1ccccc1 |
| InChI | InChI=1S/C21H15F2NO5/c1-2-27-21(26)29-16-10-24-13(8-12-6-4-3-5-7-12)11-28-20-17(23)15(22)9-14(18(20)24)19(16)25/h3-7,9-11H,2,8H2,1H3 |
| InChIKey | SPXHSXXUJVVUAH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |