C26H25F2NO6 — CID 67880277
[6,7-difluoro-3-(2-methyl-5-phenoxypentan-2-yl)-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,11-pentaen-11-yl] ethyl carbonate (PubChem CID 67880277) has the molecular formula C26H25F2NO6 and a molecular weight of 485.48 g/mol. Its IUPAC name is [6,7-difluoro-3-(2-methyl-5-phenoxypentan-2-yl)-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,11-pentaen-11-yl] ethyl carbonate.
| Compound Name | [6,7-difluoro-3-(2-methyl-5-phenoxypentan-2-yl)-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,11-pentaen-11-yl] ethyl carbonate |
|---|---|
| PubChem CID | 67880277 |
| Molecular Formula | C26H25F2NO6 |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | [6,7-difluoro-3-(2-methyl-5-phenoxypentan-2-yl)-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,11-pentaen-11-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1cn2c3c(c(F)c(F)cc3c1=O)OC(C(C)(C)CCCOc1ccccc1)=C2 |
| InChI | InChI=1S/C26H25F2NO6/c1-4-32-25(31)34-19-14-29-15-20(26(2,3)11-8-12-33-16-9-6-5-7-10-16)35-24-21(28)18(27)13-17(22(24)29)23(19)30/h5-7,9-10,13-15H,4,8,11-12H2,1-3H3 |
| InChIKey | PSPFZYSIQCOPNC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|