C18H16F3NO4 — CID 67880279
[1-(1-cyclopropylprop-2-enyl)-6,7,8-trifluoro-4-oxoquinolin-3-yl] ethyl carbonate (PubChem CID 67880279) has the molecular formula C18H16F3NO4 and a molecular weight of 367.32 g/mol. Its IUPAC name is [1-(1-cyclopropylprop-2-enyl)-6,7,8-trifluoro-4-oxoquinolin-3-yl] ethyl carbonate.
| Compound Name | [1-(1-cyclopropylprop-2-enyl)-6,7,8-trifluoro-4-oxoquinolin-3-yl] ethyl carbonate |
|---|---|
| PubChem CID | 67880279 |
| Molecular Formula | C18H16F3NO4 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | [1-(1-cyclopropylprop-2-enyl)-6,7,8-trifluoro-4-oxoquinolin-3-yl] ethyl carbonate |
| SMILES | C=CC(C1CC1)n1cc(OC(=O)OCC)c(=O)c2cc(F)c(F)c(F)c21 |
| InChI | InChI=1S/C18H16F3NO4/c1-3-12(9-5-6-9)22-8-13(26-18(24)25-4-2)17(23)10-7-11(19)14(20)15(21)16(10)22/h3,7-9,12H,1,4-6H2,2H3 |
| InChIKey | INHXNPAGYUSSLR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|