C45H37N7O2 — CID 67880833
2-butyl-3-[[2-[2-(1-trityltetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl]-5H-imidazo[4,5-c]pyridin-4-one (PubChem CID 67880833) has the molecular formula C45H37N7O2 and a molecular weight of 707.84 g/mol. Its IUPAC name is 2-butyl-3-[[2-[2-(1-trityltetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl]-5H-imidazo[4,5-c]pyridin-4-one.
| Compound Name | 2-butyl-3-[[2-[2-(1-trityltetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl]-5H-imidazo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 67880833 |
| Molecular Formula | C45H37N7O2 |
| Molecular Weight | 707.84 g/mol |
| Exact Mass | 707.30 |
| IUPAC Name | 2-butyl-3-[[2-[2-(1-trityltetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl]-5H-imidazo[4,5-c]pyridin-4-one |
| SMILES | CCCCc1nc2cc[nH]c(=O)c2n1Cc1ccc2oc(-c3ccccc3-c3nnnn3C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2c1 |
| InChI | InChI=1S/C45H37N7O2/c1-2-3-23-41-47-38-26-27-46-44(53)42(38)51(41)30-31-24-25-39-32(28-31)29-40(54-39)36-21-13-14-22-37(36)43-48-49-50-52(43)45(33-15-7-4-8-16-33,34-17-9-5-10-18-34)35-19-11-6-12-20-35/h4-22,24-29H,2-3,23,30H2,1H3,(H,46,53) |
| InChIKey | CEOBRCUFSUIMAC-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.84 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|