C21H23N3Si — CID 67890163
N-[4-(4-trimethylsilylphenyl)but-3-ynyl]quinazolin-4-amine (PubChem CID 67890163) has the molecular formula C21H23N3Si and a molecular weight of 345.52 g/mol. Its IUPAC name is N-[4-(4-trimethylsilylphenyl)but-3-ynyl]quinazolin-4-amine.
| Compound Name | N-[4-(4-trimethylsilylphenyl)but-3-ynyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 67890163 |
| Molecular Formula | C21H23N3Si |
| Molecular Weight | 345.52 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-[4-(4-trimethylsilylphenyl)but-3-ynyl]quinazolin-4-amine |
| SMILES | C[Si](C)(C)c1ccc(C#CCCNc2ncnc3ccccc23)cc1 |
| InChI | InChI=1S/C21H23N3Si/c1-25(2,3)18-13-11-17(12-14-18)8-6-7-15-22-21-19-9-4-5-10-20(19)23-16-24-21/h4-5,9-14,16H,7,15H2,1-3H3,(H,22,23,24) |
| InChIKey | FZHSJCPOORSRGN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|