C20H20N4 — CID 67890191
N-[4-[4-(dimethylamino)phenyl]but-3-ynyl]quinazolin-4-amine (PubChem CID 67890191) has the molecular formula C20H20N4 and a molecular weight of 316.41 g/mol. Its IUPAC name is N-[4-[4-(dimethylamino)phenyl]but-3-ynyl]quinazolin-4-amine.
| Compound Name | N-[4-[4-(dimethylamino)phenyl]but-3-ynyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 67890191 |
| Molecular Formula | C20H20N4 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | N-[4-[4-(dimethylamino)phenyl]but-3-ynyl]quinazolin-4-amine |
| SMILES | CN(C)c1ccc(C#CCCNc2ncnc3ccccc23)cc1 |
| InChI | InChI=1S/C20H20N4/c1-24(2)17-12-10-16(11-13-17)7-5-6-14-21-20-18-8-3-4-9-19(18)22-15-23-20/h3-4,8-13,15H,6,14H2,1-2H3,(H,21,22,23) |
| InChIKey | XGTWTYZUXBMWOT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|