C20H18N4O — CID 67890192
N-[2-[4-(quinazolin-4-ylamino)but-1-ynyl]phenyl]acetamide (PubChem CID 67890192) has the molecular formula C20H18N4O and a molecular weight of 330.39 g/mol. Its IUPAC name is N-[2-[4-(quinazolin-4-ylamino)but-1-ynyl]phenyl]acetamide.
| Compound Name | N-[2-[4-(quinazolin-4-ylamino)but-1-ynyl]phenyl]acetamide |
|---|---|
| PubChem CID | 67890192 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-[2-[4-(quinazolin-4-ylamino)but-1-ynyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccccc1C#CCCNc1ncnc2ccccc12 |
| InChI | InChI=1S/C20H18N4O/c1-15(25)24-18-11-4-2-8-16(18)9-6-7-13-21-20-17-10-3-5-12-19(17)22-14-23-20/h2-5,8,10-12,14H,7,13H2,1H3,(H,24,25)(H,21,22,23) |
| InChIKey | ISFPEQPIYHQRKV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|